Juq-158 Jun 2026
Often denotes the chronological release number within that specific series or studio library.
| Property | Details | |----------|---------| | | (provisional) 1‑(4‑fluorophenyl)-N‑[2‑(pyridin‑3‑yl)ethyl]pyrrolidine‑3‑carboxamide | | Synonyms | JUQ‑158, “Compound 158”, “Research Chemical JUQ‑158” | | Molecular formula | C₁₈H₂₀FN₃O | | Molecular weight | ≈ 311.37 g mol⁻¹ | | CAS number | Not yet assigned (as of early 2026) | | SMILES | FC1=CC=C(C=C1)C(=O)N(CC2=CN=CC=C2)C3CCCN3 | | Class (proposed) | Aryl‑pyrrolidine‑carboxamide; structurally reminiscent of certain synthetic cannabinoids and designer stimulants. | JUQ-158
If not, I can try to come up with a general essay template that you can fill in with more specific information. Often denotes the chronological release number within that